C13H17Cl2F3N2 — CID 106354539
3-chloro-N-(1-chloro-4,4-dimethylpentan-3-yl)-5-(trifluoromethyl)pyridin-2-amine (PubChem CID 106354539) has the molecular formula C13H17Cl2F3N2 and a molecular weight of 329.19 g/mol. Its IUPAC name is 3-chloro-N-(1-chloro-4,4-dimethylpentan-3-yl)-5-(trifluoromethyl)pyridin-2-amine.
| Compound Name | 3-chloro-N-(1-chloro-4,4-dimethylpentan-3-yl)-5-(trifluoromethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 106354539 |
| Molecular Formula | C13H17Cl2F3N2 |
| Molecular Weight | 329.19 g/mol |
| Exact Mass | 328.07 |
| IUPAC Name | 3-chloro-N-(1-chloro-4,4-dimethylpentan-3-yl)-5-(trifluoromethyl)pyridin-2-amine |
| SMILES | CC(C)(C)C(CCCl)Nc1ncc(C(F)(F)F)cc1Cl |
| InChI | InChI=1S/C13H17Cl2F3N2/c1-12(2,3)10(4-5-14)20-11-9(15)6-8(7-19-11)13(16,17)18/h6-7,10H,4-5H2,1-3H3,(H,19,20) |
| InChIKey | DMLMGAZYZADCCA-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.19 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|