C10H11Cl2F3N2O — CID 106181945
3-chloro-N-(1-chloro-3-methoxypropan-2-yl)-5-(trifluoromethyl)pyridin-2-amine (PubChem CID 106181945) has the molecular formula C10H11Cl2F3N2O and a molecular weight of 303.11 g/mol. Its IUPAC name is 3-chloro-N-(1-chloro-3-methoxypropan-2-yl)-5-(trifluoromethyl)pyridin-2-amine.
| Compound Name | 3-chloro-N-(1-chloro-3-methoxypropan-2-yl)-5-(trifluoromethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 106181945 |
| Molecular Formula | C10H11Cl2F3N2O |
| Molecular Weight | 303.11 g/mol |
| Exact Mass | 302.02 |
| IUPAC Name | 3-chloro-N-(1-chloro-3-methoxypropan-2-yl)-5-(trifluoromethyl)pyridin-2-amine |
| SMILES | COCC(CCl)Nc1ncc(C(F)(F)F)cc1Cl |
| InChI | InChI=1S/C10H11Cl2F3N2O/c1-18-5-7(3-11)17-9-8(12)2-6(4-16-9)10(13,14)15/h2,4,7H,3,5H2,1H3,(H,16,17) |
| InChIKey | KANQPIIBNBKZLO-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.11 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|