C10H10Cl2F3NO — CID 63205098
3-chloro-2-(2-chloro-3-methoxypropyl)-5-(trifluoromethyl)pyridine (PubChem CID 63205098) has the molecular formula C10H10Cl2F3NO and a molecular weight of 288.10 g/mol. Its IUPAC name is 3-chloro-2-(2-chloro-3-methoxypropyl)-5-(trifluoromethyl)pyridine.
| Compound Name | 3-chloro-2-(2-chloro-3-methoxypropyl)-5-(trifluoromethyl)pyridine |
|---|---|
| PubChem CID | 63205098 |
| Molecular Formula | C10H10Cl2F3NO |
| Molecular Weight | 288.10 g/mol |
| Exact Mass | 287.01 |
| IUPAC Name | 3-chloro-2-(2-chloro-3-methoxypropyl)-5-(trifluoromethyl)pyridine |
| SMILES | COCC(Cl)Cc1ncc(C(F)(F)F)cc1Cl |
| InChI | InChI=1S/C10H10Cl2F3NO/c1-17-5-7(11)3-9-8(12)2-6(4-16-9)10(13,14)15/h2,4,7H,3,5H2,1H3 |
| InChIKey | IMLNSJFCDACXSR-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.10 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|