C18H17ClF3N3O3 — CID 87526451
N-[2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]methyl]-3-(methylamino)-3-oxopropoxy]benzamide (PubChem CID 87526451) has the molecular formula C18H17ClF3N3O3 and a molecular weight of 415.80 g/mol. Its IUPAC name is N-[2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]methyl]-3-(methylamino)-3-oxopropoxy]benzamide.
| Compound Name | N-[2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]methyl]-3-(methylamino)-3-oxopropoxy]benzamide |
|---|---|
| PubChem CID | 87526451 |
| Molecular Formula | C18H17ClF3N3O3 |
| Molecular Weight | 415.80 g/mol |
| Exact Mass | 415.09 |
| IUPAC Name | N-[2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]methyl]-3-(methylamino)-3-oxopropoxy]benzamide |
| SMILES | CNC(=O)C(CONC(=O)c1ccccc1)Cc1ncc(C(F)(F)F)cc1Cl |
| InChI | InChI=1S/C18H17ClF3N3O3/c1-23-16(26)12(10-28-25-17(27)11-5-3-2-4-6-11)7-15-14(19)8-13(9-24-15)18(20,21)22/h2-6,8-9,12H,7,10H2,1H3,(H,23,26)(H,25,27) |
| InChIKey | PAQQLEWTCPEKPW-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.80 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|