C13H9ClF3NO2S — CID 1475890
2-(benzenesulfonylmethyl)-3-chloro-5-(trifluoromethyl)pyridine (PubChem CID 1475890) has the molecular formula C13H9ClF3NO2S and a molecular weight of 335.73 g/mol. Its IUPAC name is 2-(benzenesulfonylmethyl)-3-chloro-5-(trifluoromethyl)pyridine.
| Compound Name | 2-(benzenesulfonylmethyl)-3-chloro-5-(trifluoromethyl)pyridine |
|---|---|
| PubChem CID | 1475890 |
| Molecular Formula | C13H9ClF3NO2S |
| Molecular Weight | 335.73 g/mol |
| Exact Mass | 335.00 |
| IUPAC Name | 2-(benzenesulfonylmethyl)-3-chloro-5-(trifluoromethyl)pyridine |
| SMILES | O=S(=O)(Cc1ncc(C(F)(F)F)cc1Cl)c1ccccc1 |
| InChI | InChI=1S/C13H9ClF3NO2S/c14-11-6-9(13(15,16)17)7-18-12(11)8-21(19,20)10-4-2-1-3-5-10/h1-7H,8H2 |
| InChIKey | JUSNYSXYVNBTLK-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 47.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.73 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |