C8H9Cl2F3N2 — CID 22637222
2-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]ethylazanium chloride (PubChem CID 22637222) has the molecular formula C8H9Cl2F3N2 and a molecular weight of 261.07 g/mol. Its IUPAC name is 2-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]ethylazanium chloride.
| Compound Name | 2-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]ethylazanium chloride |
|---|---|
| PubChem CID | 22637222 |
| Molecular Formula | C8H9Cl2F3N2 |
| Molecular Weight | 261.07 g/mol |
| Exact Mass | 260.01 |
| IUPAC Name | 2-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]ethylazanium chloride |
| SMILES | [Cl-].[NH3+]CCc1ncc(C(F)(F)F)cc1Cl |
| InChI | InChI=1S/C8H8ClF3N2.ClH/c9-6-3-5(8(10,11)12)4-14-7(6)1-2-13;/h3-4H,1-2,13H2;1H |
| InChIKey | XZPAHUSHYKUMPU-UHFFFAOYSA-N |
| XLogP | -1.46 |
| TPSA | 40.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.07 |
| LogP ≤ 5 | -1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |