C13H9Cl2F3N2 — CID 150376040
2-chloro-5-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]methyl]aniline (PubChem CID 150376040) has the molecular formula C13H9Cl2F3N2 and a molecular weight of 321.13 g/mol. Its IUPAC name is 2-chloro-5-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]methyl]aniline.
| Compound Name | 2-chloro-5-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]methyl]aniline |
|---|---|
| PubChem CID | 150376040 |
| Molecular Formula | C13H9Cl2F3N2 |
| Molecular Weight | 321.13 g/mol |
| Exact Mass | 320.01 |
| IUPAC Name | 2-chloro-5-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]methyl]aniline |
| SMILES | Nc1cc(Cc2ncc(C(F)(F)F)cc2Cl)ccc1Cl |
| InChI | InChI=1S/C13H9Cl2F3N2/c14-9-2-1-7(3-11(9)19)4-12-10(15)5-8(6-20-12)13(16,17)18/h1-3,5-6H,4,19H2 |
| InChIKey | GYSHDMYNWFHIEI-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.13 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|