C20H20ClF3N2O2 — CID 40543207
(E,4R)-4-[4-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]methyl]phenoxy]-1-(dimethylamino)pent-1-en-3-one (PubChem CID 40543207) has the molecular formula C20H20ClF3N2O2 and a molecular weight of 412.84 g/mol. Its IUPAC name is (E,4R)-4-[4-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]methyl]phenoxy]-1-(dimethylamino)pent-1-en-3-one.
| Compound Name | (E,4R)-4-[4-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]methyl]phenoxy]-1-(dimethylamino)pent-1-en-3-one |
|---|---|
| PubChem CID | 40543207 |
| Molecular Formula | C20H20ClF3N2O2 |
| Molecular Weight | 412.84 g/mol |
| Exact Mass | 412.12 |
| IUPAC Name | (E,4R)-4-[4-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]methyl]phenoxy]-1-(dimethylamino)pent-1-en-3-one |
| SMILES | C[C@@H](Oc1ccc(Cc2ncc(C(F)(F)F)cc2Cl)cc1)C(=O)/C=C/N(C)C |
| InChI | InChI=1S/C20H20ClF3N2O2/c1-13(19(27)8-9-26(2)3)28-16-6-4-14(5-7-16)10-18-17(21)11-15(12-25-18)20(22,23)24/h4-9,11-13H,10H2,1-3H3/b9-8+/t13-/m1/s1 |
| InChIKey | RMCUCRSMTVLFCC-MMQHEFTJSA-N |
| XLogP | 4.76 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.84 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|