C15H11ClF3NO3 — CID 75175960
methyl 4-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]methoxy]benzoate (PubChem CID 75175960) has the molecular formula C15H11ClF3NO3 and a molecular weight of 345.70 g/mol. Its IUPAC name is methyl 4-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]methoxy]benzoate.
| Compound Name | methyl 4-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]methoxy]benzoate |
|---|---|
| PubChem CID | 75175960 |
| Molecular Formula | C15H11ClF3NO3 |
| Molecular Weight | 345.70 g/mol |
| Exact Mass | 345.04 |
| IUPAC Name | methyl 4-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]methoxy]benzoate |
| SMILES | COC(=O)c1ccc(OCc2ncc(C(F)(F)F)cc2Cl)cc1 |
| InChI | InChI=1S/C15H11ClF3NO3/c1-22-14(21)9-2-4-11(5-3-9)23-8-13-12(16)6-10(7-20-13)15(17,18)19/h2-7H,8H2,1H3 |
| InChIKey | BTBOMKOXJVGBRU-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.70 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |