C16H14ClF3N4OS — CID 2746276
[1-[4-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]methoxy]phenyl]ethylideneamino]thiourea (PubChem CID 2746276) has the molecular formula C16H14ClF3N4OS and a molecular weight of 402.83 g/mol. Its IUPAC name is [1-[4-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]methoxy]phenyl]ethylideneamino]thiourea.
| Compound Name | [1-[4-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]methoxy]phenyl]ethylideneamino]thiourea |
|---|---|
| PubChem CID | 2746276 |
| Molecular Formula | C16H14ClF3N4OS |
| Molecular Weight | 402.83 g/mol |
| Exact Mass | 402.05 |
| IUPAC Name | [1-[4-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]methoxy]phenyl]ethylideneamino]thiourea |
| SMILES | CC(=NNC(N)=S)c1ccc(OCc2ncc(C(F)(F)F)cc2Cl)cc1 |
| InChI | InChI=1S/C16H14ClF3N4OS/c1-9(23-24-15(21)26)10-2-4-12(5-3-10)25-8-14-13(17)6-11(7-22-14)16(18,19)20/h2-7H,8H2,1H3,(H3,21,24,26) |
| InChIKey | QHVRCHSDKXCBMS-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 72.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.83 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|