C19H16F3N5S — CID 91382598
[1-[4-[[7-(trifluoromethyl)quinolin-4-yl]amino]phenyl]ethylideneamino]thiourea (PubChem CID 91382598) has the molecular formula C19H16F3N5S and a molecular weight of 403.43 g/mol. Its IUPAC name is [1-[4-[[7-(trifluoromethyl)quinolin-4-yl]amino]phenyl]ethylideneamino]thiourea.
| Compound Name | [1-[4-[[7-(trifluoromethyl)quinolin-4-yl]amino]phenyl]ethylideneamino]thiourea |
|---|---|
| PubChem CID | 91382598 |
| Molecular Formula | C19H16F3N5S |
| Molecular Weight | 403.43 g/mol |
| Exact Mass | 403.11 |
| IUPAC Name | [1-[4-[[7-(trifluoromethyl)quinolin-4-yl]amino]phenyl]ethylideneamino]thiourea |
| SMILES | CC(=NNC(N)=S)c1ccc(Nc2ccnc3cc(C(F)(F)F)ccc23)cc1 |
| InChI | InChI=1S/C19H16F3N5S/c1-11(26-27-18(23)28)12-2-5-14(6-3-12)25-16-8-9-24-17-10-13(19(20,21)22)4-7-15(16)17/h2-10H,1H3,(H,24,25)(H3,23,27,28) |
| InChIKey | NUIGANWVPVWJRU-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 75.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.43 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|