C21H20F3N3O — CID 175308750
2,4-diethyl-3-[[7-(trifluoromethyl)quinolin-4-yl]amino]benzamide (PubChem CID 175308750) has the molecular formula C21H20F3N3O and a molecular weight of 387.41 g/mol. Its IUPAC name is 2,4-diethyl-3-[[7-(trifluoromethyl)quinolin-4-yl]amino]benzamide.
| Compound Name | 2,4-diethyl-3-[[7-(trifluoromethyl)quinolin-4-yl]amino]benzamide |
|---|---|
| PubChem CID | 175308750 |
| Molecular Formula | C21H20F3N3O |
| Molecular Weight | 387.41 g/mol |
| Exact Mass | 387.16 |
| IUPAC Name | 2,4-diethyl-3-[[7-(trifluoromethyl)quinolin-4-yl]amino]benzamide |
| SMILES | CCc1ccc(C(N)=O)c(CC)c1Nc1ccnc2cc(C(F)(F)F)ccc12 |
| InChI | InChI=1S/C21H20F3N3O/c1-3-12-5-7-15(20(25)28)14(4-2)19(12)27-17-9-10-26-18-11-13(21(22,23)24)6-8-16(17)18/h5-11H,3-4H2,1-2H3,(H2,25,28)(H,26,27) |
| InChIKey | NXKKXYAKDXMEIR-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.41 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |