C19H14ClF3N2O2 — CID 157172040
methyl 2-[2-[(7-chloroquinolin-4-yl)amino]-4-(trifluoromethyl)phenyl]acetate (PubChem CID 157172040) has the molecular formula C19H14ClF3N2O2 and a molecular weight of 394.78 g/mol. Its IUPAC name is methyl 2-[2-[(7-chloroquinolin-4-yl)amino]-4-(trifluoromethyl)phenyl]acetate.
| Compound Name | methyl 2-[2-[(7-chloroquinolin-4-yl)amino]-4-(trifluoromethyl)phenyl]acetate |
|---|---|
| PubChem CID | 157172040 |
| Molecular Formula | C19H14ClF3N2O2 |
| Molecular Weight | 394.78 g/mol |
| Exact Mass | 394.07 |
| IUPAC Name | methyl 2-[2-[(7-chloroquinolin-4-yl)amino]-4-(trifluoromethyl)phenyl]acetate |
| SMILES | COC(=O)Cc1ccc(C(F)(F)F)cc1Nc1ccnc2cc(Cl)ccc12 |
| InChI | InChI=1S/C19H14ClF3N2O2/c1-27-18(26)8-11-2-3-12(19(21,22)23)9-16(11)25-15-6-7-24-17-10-13(20)4-5-14(15)17/h2-7,9-10H,8H2,1H3,(H,24,25) |
| InChIKey | ANOUEUCFQXIGMD-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.78 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |