C25H17ClF3N5O2 — CID 86578782
N-[4-[(7-chloroquinolin-4-yl)amino]phenyl]-N'-[(E)-[4-(trifluoromethyl)phenyl]methylideneamino]oxamide (PubChem CID 86578782) has the molecular formula C25H17ClF3N5O2 and a molecular weight of 511.89 g/mol. Its IUPAC name is N-[4-[(7-chloroquinolin-4-yl)amino]phenyl]-N'-[(E)-[4-(trifluoromethyl)phenyl]methylideneamino]oxamide.
| Compound Name | N-[4-[(7-chloroquinolin-4-yl)amino]phenyl]-N'-[(E)-[4-(trifluoromethyl)phenyl]methylideneamino]oxamide |
|---|---|
| PubChem CID | 86578782 |
| Molecular Formula | C25H17ClF3N5O2 |
| Molecular Weight | 511.89 g/mol |
| Exact Mass | 511.10 |
| IUPAC Name | N-[4-[(7-chloroquinolin-4-yl)amino]phenyl]-N'-[(E)-[4-(trifluoromethyl)phenyl]methylideneamino]oxamide |
| SMILES | O=C(N/N=C/c1ccc(C(F)(F)F)cc1)C(=O)Nc1ccc(Nc2ccnc3cc(Cl)ccc23)cc1 |
| InChI | InChI=1S/C25H17ClF3N5O2/c26-17-5-10-20-21(11-12-30-22(20)13-17)32-18-6-8-19(9-7-18)33-23(35)24(36)34-31-14-15-1-3-16(4-2-15)25(27,28)29/h1-14H,(H,30,32)(H,33,35)(H,34,36)/b31-14+ |
| InChIKey | JVMPCMIZEDAOMA-XAZZYMPDSA-N |
| XLogP | 5.74 |
| TPSA | 95.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.89 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|