C24H15Cl3N2O — CID 69174723
3-[4-[(7-chloroquinolin-4-yl)amino]phenyl]-1-(2,4-dichlorophenyl)prop-2-en-1-one (PubChem CID 69174723) has the molecular formula C24H15Cl3N2O and a molecular weight of 453.76 g/mol. Its IUPAC name is 3-[4-[(7-chloroquinolin-4-yl)amino]phenyl]-1-(2,4-dichlorophenyl)prop-2-en-1-one.
| Compound Name | 3-[4-[(7-chloroquinolin-4-yl)amino]phenyl]-1-(2,4-dichlorophenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 69174723 |
| Molecular Formula | C24H15Cl3N2O |
| Molecular Weight | 453.76 g/mol |
| Exact Mass | 452.02 |
| IUPAC Name | 3-[4-[(7-chloroquinolin-4-yl)amino]phenyl]-1-(2,4-dichlorophenyl)prop-2-en-1-one |
| SMILES | O=C(C=Cc1ccc(Nc2ccnc3cc(Cl)ccc23)cc1)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C24H15Cl3N2O/c25-16-4-8-19(21(27)13-16)24(30)10-3-15-1-6-18(7-2-15)29-22-11-12-28-23-14-17(26)5-9-20(22)23/h1-14H,(H,28,29) |
| InChIKey | UNNSPHJEXDJMSP-UHFFFAOYSA-N |
| XLogP | 7.83 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.76 |
| LogP ≤ 5 | 7.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|