C17H14Cl2O — CID 19564738
(E)-1-(2,4-dichlorophenyl)-3-(4-ethylphenyl)prop-2-en-1-one (PubChem CID 19564738) has the molecular formula C17H14Cl2O and a molecular weight of 305.20 g/mol. Its IUPAC name is (E)-1-(2,4-dichlorophenyl)-3-(4-ethylphenyl)prop-2-en-1-one.
| Compound Name | (E)-1-(2,4-dichlorophenyl)-3-(4-ethylphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 19564738 |
| Molecular Formula | C17H14Cl2O |
| Molecular Weight | 305.20 g/mol |
| Exact Mass | 304.04 |
| IUPAC Name | (E)-1-(2,4-dichlorophenyl)-3-(4-ethylphenyl)prop-2-en-1-one |
| SMILES | CCc1ccc(/C=C/C(=O)c2ccc(Cl)cc2Cl)cc1 |
| InChI | InChI=1S/C17H14Cl2O/c1-2-12-3-5-13(6-4-12)7-10-17(20)15-9-8-14(18)11-16(15)19/h3-11H,2H2,1H3/b10-7+ |
| InChIKey | YVFRTOCVSCAYKR-JXMROGBWSA-N |
| XLogP | 5.45 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.20 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|