C14H12Cl2N2O — CID 19562963
(E)-1-(2,4-dichlorophenyl)-3-(1-ethylpyrazol-4-yl)prop-2-en-1-one (PubChem CID 19562963) has the molecular formula C14H12Cl2N2O and a molecular weight of 295.17 g/mol. Its IUPAC name is (E)-1-(2,4-dichlorophenyl)-3-(1-ethylpyrazol-4-yl)prop-2-en-1-one.
| Compound Name | (E)-1-(2,4-dichlorophenyl)-3-(1-ethylpyrazol-4-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 19562963 |
| Molecular Formula | C14H12Cl2N2O |
| Molecular Weight | 295.17 g/mol |
| Exact Mass | 294.03 |
| IUPAC Name | (E)-1-(2,4-dichlorophenyl)-3-(1-ethylpyrazol-4-yl)prop-2-en-1-one |
| SMILES | CCn1cc(/C=C/C(=O)c2ccc(Cl)cc2Cl)cn1 |
| InChI | InChI=1S/C14H12Cl2N2O/c1-2-18-9-10(8-17-18)3-6-14(19)12-5-4-11(15)7-13(12)16/h3-9H,2H2,1H3/b6-3+ |
| InChIKey | WGHKVGTYTHQNQF-ZZXKWVIFSA-N |
| XLogP | 4.11 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.17 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|