C27H19Cl2NO — CID 4555105
1-(2,4-dichlorophenyl)-3-[4-(N-phenylanilino)phenyl]prop-2-en-1-one (PubChem CID 4555105) has the molecular formula C27H19Cl2NO and a molecular weight of 444.36 g/mol. Its IUPAC name is 1-(2,4-dichlorophenyl)-3-[4-(N-phenylanilino)phenyl]prop-2-en-1-one.
| Compound Name | 1-(2,4-dichlorophenyl)-3-[4-(N-phenylanilino)phenyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 4555105 |
| Molecular Formula | C27H19Cl2NO |
| Molecular Weight | 444.36 g/mol |
| Exact Mass | 443.08 |
| IUPAC Name | 1-(2,4-dichlorophenyl)-3-[4-(N-phenylanilino)phenyl]prop-2-en-1-one |
| SMILES | O=C(C=Cc1ccc(N(c2ccccc2)c2ccccc2)cc1)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C27H19Cl2NO/c28-21-14-17-25(26(29)19-21)27(31)18-13-20-11-15-24(16-12-20)30(22-7-3-1-4-8-22)23-9-5-2-6-10-23/h1-19H |
| InChIKey | HYXXARXOFIKNOM-UHFFFAOYSA-N |
| XLogP | 8.36 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.36 |
| LogP ≤ 5 | 8.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|