C16H12Cl2O — CID 3633437
1-(2,4-dichlorophenyl)-3-(2-methylphenyl)prop-2-en-1-one (PubChem CID 3633437) has the molecular formula C16H12Cl2O and a molecular weight of 291.18 g/mol. Its IUPAC name is 1-(2,4-dichlorophenyl)-3-(2-methylphenyl)prop-2-en-1-one.
| Compound Name | 1-(2,4-dichlorophenyl)-3-(2-methylphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 3633437 |
| Molecular Formula | C16H12Cl2O |
| Molecular Weight | 291.18 g/mol |
| Exact Mass | 290.03 |
| IUPAC Name | 1-(2,4-dichlorophenyl)-3-(2-methylphenyl)prop-2-en-1-one |
| SMILES | Cc1ccccc1C=CC(=O)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C16H12Cl2O/c1-11-4-2-3-5-12(11)6-9-16(19)14-8-7-13(17)10-15(14)18/h2-10H,1H3 |
| InChIKey | GIJSNCFEMSUPQS-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.18 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|