C21H28O — CID 91348083
(E)-1,3-bis(2-methylphenyl)prop-2-en-1-one;ethane (PubChem CID 91348083) has the molecular formula C21H28O and a molecular weight of 296.45 g/mol. Its IUPAC name is (E)-1,3-bis(2-methylphenyl)prop-2-en-1-one;ethane.
| Compound Name | (E)-1,3-bis(2-methylphenyl)prop-2-en-1-one;ethane |
|---|---|
| PubChem CID | 91348083 |
| Molecular Formula | C21H28O |
| Molecular Weight | 296.45 g/mol |
| Exact Mass | 296.21 |
| IUPAC Name | (E)-1,3-bis(2-methylphenyl)prop-2-en-1-one;ethane |
| SMILES | CC.CC.Cc1ccccc1/C=C/C(=O)c1ccccc1C |
| InChI | InChI=1S/C17H16O.2C2H6/c1-13-7-3-5-9-15(13)11-12-17(18)16-10-6-4-8-14(16)2;2*1-2/h3-12H,1-2H3;2*1-2H3/b12-11+;; |
| InChIKey | PGEJQEUEXGIULJ-YHPRVSEPSA-N |
| XLogP | 6.25 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.45 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|