C16H9F5O — CID 9448324
(E)-1-(2-methylphenyl)-3-(2,3,4,5,6-pentafluorophenyl)prop-2-en-1-one (PubChem CID 9448324) has the molecular formula C16H9F5O and a molecular weight of 312.24 g/mol. Its IUPAC name is (E)-1-(2-methylphenyl)-3-(2,3,4,5,6-pentafluorophenyl)prop-2-en-1-one.
| Compound Name | (E)-1-(2-methylphenyl)-3-(2,3,4,5,6-pentafluorophenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 9448324 |
| Molecular Formula | C16H9F5O |
| Molecular Weight | 312.24 g/mol |
| Exact Mass | 312.06 |
| IUPAC Name | (E)-1-(2-methylphenyl)-3-(2,3,4,5,6-pentafluorophenyl)prop-2-en-1-one |
| SMILES | Cc1ccccc1C(=O)/C=C/c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C16H9F5O/c1-8-4-2-3-5-9(8)11(22)7-6-10-12(17)14(19)16(21)15(20)13(10)18/h2-7H,1H3/b7-6+ |
| InChIKey | IIPHVKMCZYPAFJ-VOTSOKGWSA-N |
| XLogP | 4.59 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.24 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|