C15H5F7O — CID 8853474
(E)-1-(2,6-difluorophenyl)-3-(2,3,4,5,6-pentafluorophenyl)prop-2-en-1-one (PubChem CID 8853474) has the molecular formula C15H5F7O and a molecular weight of 334.19 g/mol. Its IUPAC name is (E)-1-(2,6-difluorophenyl)-3-(2,3,4,5,6-pentafluorophenyl)prop-2-en-1-one.
| Compound Name | (E)-1-(2,6-difluorophenyl)-3-(2,3,4,5,6-pentafluorophenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 8853474 |
| Molecular Formula | C15H5F7O |
| Molecular Weight | 334.19 g/mol |
| Exact Mass | 334.02 |
| IUPAC Name | (E)-1-(2,6-difluorophenyl)-3-(2,3,4,5,6-pentafluorophenyl)prop-2-en-1-one |
| SMILES | O=C(/C=C/c1c(F)c(F)c(F)c(F)c1F)c1c(F)cccc1F |
| InChI | InChI=1S/C15H5F7O/c16-7-2-1-3-8(17)10(7)9(23)5-4-6-11(18)13(20)15(22)14(21)12(6)19/h1-5H/b5-4+ |
| InChIKey | JJROQWOOJTZPDK-SNAWJCMRSA-N |
| XLogP | 4.56 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.19 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|