C10H8F2O — CID 18371119
(E)-4-(2,6-difluorophenyl)but-3-en-2-one (PubChem CID 18371119) has the molecular formula C10H8F2O and a molecular weight of 182.17 g/mol. Its IUPAC name is (E)-4-(2,6-difluorophenyl)but-3-en-2-one.
| Compound Name | (E)-4-(2,6-difluorophenyl)but-3-en-2-one |
|---|---|
| PubChem CID | 18371119 |
| Molecular Formula | C10H8F2O |
| Molecular Weight | 182.17 g/mol |
| Exact Mass | 182.05 |
| IUPAC Name | (E)-4-(2,6-difluorophenyl)but-3-en-2-one |
| SMILES | CC(=O)/C=C/c1c(F)cccc1F |
| InChI | InChI=1S/C10H8F2O/c1-7(13)5-6-8-9(11)3-2-4-10(8)12/h2-6H,1H3/b6-5+ |
| InChIKey | BLVPHVLDBNYNNO-AATRIKPKSA-N |
| XLogP | 2.57 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.17 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|