C9H5ClF2O — CID 11424232
(E)-3-(2,6-difluorophenyl)prop-2-enoyl chloride (PubChem CID 11424232) has the molecular formula C9H5ClF2O and a molecular weight of 202.59 g/mol. Its IUPAC name is (E)-3-(2,6-difluorophenyl)prop-2-enoyl chloride.
| Compound Name | (E)-3-(2,6-difluorophenyl)prop-2-enoyl chloride |
|---|---|
| PubChem CID | 11424232 |
| Molecular Formula | C9H5ClF2O |
| Molecular Weight | 202.59 g/mol |
| Exact Mass | 202.00 |
| IUPAC Name | (E)-3-(2,6-difluorophenyl)prop-2-enoyl chloride |
| SMILES | O=C(Cl)/C=C/c1c(F)cccc1F |
| InChI | InChI=1S/C9H5ClF2O/c10-9(13)5-4-6-7(11)2-1-3-8(6)12/h1-5H/b5-4+ |
| InChIKey | VFNAKBIRARWDFR-SNAWJCMRSA-N |
| XLogP | 2.74 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.59 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|