C10H7ClF2O — CID 123503283
4-(3-chloro-2,6-difluorophenyl)but-3-en-2-one (PubChem CID 123503283) has the molecular formula C10H7ClF2O and a molecular weight of 216.61 g/mol. Its IUPAC name is 4-(3-chloro-2,6-difluorophenyl)but-3-en-2-one.
| Compound Name | 4-(3-chloro-2,6-difluorophenyl)but-3-en-2-one |
|---|---|
| PubChem CID | 123503283 |
| Molecular Formula | C10H7ClF2O |
| Molecular Weight | 216.61 g/mol |
| Exact Mass | 216.02 |
| IUPAC Name | 4-(3-chloro-2,6-difluorophenyl)but-3-en-2-one |
| SMILES | CC(=O)C=Cc1c(F)ccc(Cl)c1F |
| InChI | InChI=1S/C10H7ClF2O/c1-6(14)2-3-7-9(12)5-4-8(11)10(7)13/h2-5H,1H3 |
| InChIKey | RPZWMMLBQOCFCT-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.61 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|