C9H5ClF2O2 — CID 2773558
3-(3-chloro-2,6-difluorophenyl)prop-2-enoic acid (PubChem CID 2773558) has the molecular formula C9H5ClF2O2 and a molecular weight of 218.59 g/mol. Its IUPAC name is 3-(3-chloro-2,6-difluorophenyl)prop-2-enoic acid.
| Compound Name | 3-(3-chloro-2,6-difluorophenyl)prop-2-enoic acid |
|---|---|
| PubChem CID | 2773558 |
| Molecular Formula | C9H5ClF2O2 |
| Molecular Weight | 218.59 g/mol |
| Exact Mass | 217.99 |
| IUPAC Name | 3-(3-chloro-2,6-difluorophenyl)prop-2-enoic acid |
| SMILES | O=C(O)C=Cc1c(F)ccc(Cl)c1F |
| InChI | InChI=1S/C9H5ClF2O2/c10-6-2-3-7(11)5(9(6)12)1-4-8(13)14/h1-4H,(H,13,14) |
| InChIKey | ZNEJUDVVYPYXMB-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.59 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|