C9H8ClF2N — CID 131272725
3-(3-chloro-2,6-difluorophenyl)prop-2-en-1-amine (PubChem CID 131272725) has the molecular formula C9H8ClF2N and a molecular weight of 203.62 g/mol. Its IUPAC name is 3-(3-chloro-2,6-difluorophenyl)prop-2-en-1-amine.
| Compound Name | 3-(3-chloro-2,6-difluorophenyl)prop-2-en-1-amine |
|---|---|
| PubChem CID | 131272725 |
| Molecular Formula | C9H8ClF2N |
| Molecular Weight | 203.62 g/mol |
| Exact Mass | 203.03 |
| IUPAC Name | 3-(3-chloro-2,6-difluorophenyl)prop-2-en-1-amine |
| SMILES | NCC=Cc1c(F)ccc(Cl)c1F |
| InChI | InChI=1S/C9H8ClF2N/c10-7-3-4-8(11)6(9(7)12)2-1-5-13/h1-4H,5,13H2 |
| InChIKey | HWFQROLQKVYAGK-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.62 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|