(E)-3-(3-bromo-2,6-dichlorophenyl)prop-2-enoic acid

C9H5BrCl2O2 — CID 171032879

IUPAC(E)-3-(3-bromo-2,6-dichlorophenyl)prop-2-enoic acid
SMILESO=C(O)/C=C/c1c(Cl)ccc(Br)c1Cl
InChIInChI=1S/C9H5BrCl2O2/c10-6-2-3-7(11)5(9(6)12)1-4-8(13)14/h1-4H,(H,13,14)/b4-1+
InChIKeyLESFGUVZUBGBLK-DAFODLJHSA-N
MW295.95 g/mol
LogP3.85
Rot. Bonds2

About (E)-3-(3-bromo-2,6-dichlorophenyl)prop-2-enoic acid

(E)-3-(3-bromo-2,6-dichlorophenyl)prop-2-enoic acid (PubChem CID 171032879) has the molecular formula C9H5BrCl2O2 and a molecular weight of 295.95 g/mol. Its IUPAC name is (E)-3-(3-bromo-2,6-dichlorophenyl)prop-2-enoic acid.

Molecular Properties

Compound Name(E)-3-(3-bromo-2,6-dichlorophenyl)prop-2-enoic acid
PubChem CID171032879
Molecular FormulaC9H5BrCl2O2
Molecular Weight295.95 g/mol
Exact Mass293.88
IUPAC Name(E)-3-(3-bromo-2,6-dichlorophenyl)prop-2-enoic acid
SMILESO=C(O)/C=C/c1c(Cl)ccc(Br)c1Cl
InChIInChI=1S/C9H5BrCl2O2/c10-6-2-3-7(11)5(9(6)12)1-4-8(13)14/h1-4H,(H,13,14)/b4-1+
InChIKeyLESFGUVZUBGBLK-DAFODLJHSA-N
XLogP3.85
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds2
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500295.95
LogP ≤ 53.85
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze (E)-3-(3-bromo-2,6-dichlorophenyl)prop-2-enoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (E)-3-(3-bromo-2,6-dichlorophenyl)prop-2-enoic acid?
The IUPAC name of (E)-3-(3-bromo-2,6-dichlorophenyl)prop-2-enoic acid (CID 171032879) is (E)-3-(3-bromo-2,6-dichlorophenyl)prop-2-enoic acid.
What is the SMILES notation for (E)-3-(3-bromo-2,6-dichlorophenyl)prop-2-enoic acid?
The canonical SMILES for (E)-3-(3-bromo-2,6-dichlorophenyl)prop-2-enoic acid is O=C(O)/C=C/c1c(Cl)ccc(Br)c1Cl.
What is the InChIKey of (E)-3-(3-bromo-2,6-dichlorophenyl)prop-2-enoic acid?
The InChIKey is LESFGUVZUBGBLK-DAFODLJHSA-N. The full InChI is InChI=1S/C9H5BrCl2O2/c10-6-2-3-7(11)5(9(6)12)1-4-8(13)14/h1-4H,(H,13,14)/b4-1+.
What are the key properties of (E)-3-(3-bromo-2,6-dichlorophenyl)prop-2-enoic acid?
(E)-3-(3-bromo-2,6-dichlorophenyl)prop-2-enoic acid has a molecular weight of 295.95 g/mol, XLogP of 3.85, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-3-(3-bromo-2,6-dichlorophenyl)prop-2-enoic acid is sourced from PubChem (CID 171032879), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).