C10H7Cl3O — CID 67086478
(E)-4-(2,4,6-trichlorophenyl)but-3-en-2-one (PubChem CID 67086478) has the molecular formula C10H7Cl3O and a molecular weight of 249.52 g/mol. Its IUPAC name is (E)-4-(2,4,6-trichlorophenyl)but-3-en-2-one.
| Compound Name | (E)-4-(2,4,6-trichlorophenyl)but-3-en-2-one |
|---|---|
| PubChem CID | 67086478 |
| Molecular Formula | C10H7Cl3O |
| Molecular Weight | 249.52 g/mol |
| Exact Mass | 247.96 |
| IUPAC Name | (E)-4-(2,4,6-trichlorophenyl)but-3-en-2-one |
| SMILES | CC(=O)/C=C/c1c(Cl)cc(Cl)cc1Cl |
| InChI | InChI=1S/C10H7Cl3O/c1-6(14)2-3-8-9(12)4-7(11)5-10(8)13/h2-5H,1H3/b3-2+ |
| InChIKey | NCFKNCDEZZOLAI-NSCUHMNNSA-N |
| XLogP | 4.25 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.52 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|