C16H13Cl2NO4S — CID 69281379
3,5-dichloro-2-hydroxy-N-[4-[(E)-3-oxobut-1-enyl]phenyl]benzenesulfonamide (PubChem CID 69281379) has the molecular formula C16H13Cl2NO4S and a molecular weight of 386.26 g/mol. Its IUPAC name is 3,5-dichloro-2-hydroxy-N-[4-[(E)-3-oxobut-1-enyl]phenyl]benzenesulfonamide.
| Compound Name | 3,5-dichloro-2-hydroxy-N-[4-[(E)-3-oxobut-1-enyl]phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 69281379 |
| Molecular Formula | C16H13Cl2NO4S |
| Molecular Weight | 386.26 g/mol |
| Exact Mass | 384.99 |
| IUPAC Name | 3,5-dichloro-2-hydroxy-N-[4-[(E)-3-oxobut-1-enyl]phenyl]benzenesulfonamide |
| SMILES | CC(=O)/C=C/c1ccc(NS(=O)(=O)c2cc(Cl)cc(Cl)c2O)cc1 |
| InChI | InChI=1S/C16H13Cl2NO4S/c1-10(20)2-3-11-4-6-13(7-5-11)19-24(22,23)15-9-12(17)8-14(18)16(15)21/h2-9,19,21H,1H3/b3-2+ |
| InChIKey | WQSBQNJNRGXKPJ-NSCUHMNNSA-N |
| XLogP | 4.10 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.26 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulfonamide_A(43)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|