C13H7Cl2F4NO3S — CID 3751185
3,5-dichloro-N-[4-fluoro-3-(trifluoromethyl)phenyl]-2-hydroxybenzenesulfonamide (PubChem CID 3751185) has the molecular formula C13H7Cl2F4NO3S and a molecular weight of 404.17 g/mol. Its IUPAC name is 3,5-dichloro-N-[4-fluoro-3-(trifluoromethyl)phenyl]-2-hydroxybenzenesulfonamide.
| Compound Name | 3,5-dichloro-N-[4-fluoro-3-(trifluoromethyl)phenyl]-2-hydroxybenzenesulfonamide |
|---|---|
| PubChem CID | 3751185 |
| Molecular Formula | C13H7Cl2F4NO3S |
| Molecular Weight | 404.17 g/mol |
| Exact Mass | 402.95 |
| IUPAC Name | 3,5-dichloro-N-[4-fluoro-3-(trifluoromethyl)phenyl]-2-hydroxybenzenesulfonamide |
| SMILES | O=S(=O)(Nc1ccc(F)c(C(F)(F)F)c1)c1cc(Cl)cc(Cl)c1O |
| InChI | InChI=1S/C13H7Cl2F4NO3S/c14-6-3-9(15)12(21)11(4-6)24(22,23)20-7-1-2-10(16)8(5-7)13(17,18)19/h1-5,20-21H |
| InChIKey | IFIBRWCOFCPBLW-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.17 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulfonamide_A(43)', 'substructure': 'N/A'} |
|---|