C16H15Cl2N3O3S — CID 146600973
3,5-dichloro-2-hydroxy-N-(1-propan-2-ylindazol-5-yl)benzenesulfonamide (PubChem CID 146600973) has the molecular formula C16H15Cl2N3O3S and a molecular weight of 400.29 g/mol. Its IUPAC name is 3,5-dichloro-2-hydroxy-N-(1-propan-2-ylindazol-5-yl)benzenesulfonamide.
| Compound Name | 3,5-dichloro-2-hydroxy-N-(1-propan-2-ylindazol-5-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 146600973 |
| Molecular Formula | C16H15Cl2N3O3S |
| Molecular Weight | 400.29 g/mol |
| Exact Mass | 399.02 |
| IUPAC Name | 3,5-dichloro-2-hydroxy-N-(1-propan-2-ylindazol-5-yl)benzenesulfonamide |
| SMILES | CC(C)n1ncc2cc(NS(=O)(=O)c3cc(Cl)cc(Cl)c3O)ccc21 |
| InChI | InChI=1S/C16H15Cl2N3O3S/c1-9(2)21-14-4-3-12(5-10(14)8-19-21)20-25(23,24)15-7-11(17)6-13(18)16(15)22/h3-9,20,22H,1-2H3 |
| InChIKey | ZHELENJZIXLAAK-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.29 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulfonamide_A(43)', 'substructure': 'N/A'} |
|---|