C16H14Cl2N2O4S — CID 167899475
3,5-dichloro-N-(3-cyano-4-propan-2-yloxyphenyl)-2-hydroxybenzenesulfonamide (PubChem CID 167899475) has the molecular formula C16H14Cl2N2O4S and a molecular weight of 401.27 g/mol. Its IUPAC name is 3,5-dichloro-N-(3-cyano-4-propan-2-yloxyphenyl)-2-hydroxybenzenesulfonamide.
| Compound Name | 3,5-dichloro-N-(3-cyano-4-propan-2-yloxyphenyl)-2-hydroxybenzenesulfonamide |
|---|---|
| PubChem CID | 167899475 |
| Molecular Formula | C16H14Cl2N2O4S |
| Molecular Weight | 401.27 g/mol |
| Exact Mass | 400.01 |
| IUPAC Name | 3,5-dichloro-N-(3-cyano-4-propan-2-yloxyphenyl)-2-hydroxybenzenesulfonamide |
| SMILES | CC(C)Oc1ccc(NS(=O)(=O)c2cc(Cl)cc(Cl)c2O)cc1C#N |
| InChI | InChI=1S/C16H14Cl2N2O4S/c1-9(2)24-14-4-3-12(5-10(14)8-19)20-25(22,23)15-7-11(17)6-13(18)16(15)21/h3-7,9,20-21H,1-2H3 |
| InChIKey | CSBILONDNQGMCG-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 99.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.27 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulfonamide_A(43)', 'substructure': 'N/A'} |
|---|