C15H10ClIN2O5S — CID 167830599
5-chloro-4-[(4-cyano-3-iodophenyl)sulfamoyl]-2-methoxybenzoic acid (PubChem CID 167830599) has the molecular formula C15H10ClIN2O5S and a molecular weight of 492.68 g/mol. Its IUPAC name is 5-chloro-4-[(4-cyano-3-iodophenyl)sulfamoyl]-2-methoxybenzoic acid.
| Compound Name | 5-chloro-4-[(4-cyano-3-iodophenyl)sulfamoyl]-2-methoxybenzoic acid |
|---|---|
| PubChem CID | 167830599 |
| Molecular Formula | C15H10ClIN2O5S |
| Molecular Weight | 492.68 g/mol |
| Exact Mass | 491.90 |
| IUPAC Name | 5-chloro-4-[(4-cyano-3-iodophenyl)sulfamoyl]-2-methoxybenzoic acid |
| SMILES | COc1cc(S(=O)(=O)Nc2ccc(C#N)c(I)c2)c(Cl)cc1C(=O)O |
| InChI | InChI=1S/C15H10ClIN2O5S/c1-24-13-6-14(11(16)5-10(13)15(20)21)25(22,23)19-9-3-2-8(7-18)12(17)4-9/h2-6,19H,1H3,(H,20,21) |
| InChIKey | WIMAZRGCMCHXKX-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 116.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.68 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|