C12H11ClN2O6S — CID 139003553
5-chloro-2-methoxy-4-(1,2-oxazol-3-ylmethylsulfamoyl)benzoic acid (PubChem CID 139003553) has the molecular formula C12H11ClN2O6S and a molecular weight of 346.75 g/mol. Its IUPAC name is 5-chloro-2-methoxy-4-(1,2-oxazol-3-ylmethylsulfamoyl)benzoic acid.
| Compound Name | 5-chloro-2-methoxy-4-(1,2-oxazol-3-ylmethylsulfamoyl)benzoic acid |
|---|---|
| PubChem CID | 139003553 |
| Molecular Formula | C12H11ClN2O6S |
| Molecular Weight | 346.75 g/mol |
| Exact Mass | 346.00 |
| IUPAC Name | 5-chloro-2-methoxy-4-(1,2-oxazol-3-ylmethylsulfamoyl)benzoic acid |
| SMILES | COc1cc(S(=O)(=O)NCc2ccon2)c(Cl)cc1C(=O)O |
| InChI | InChI=1S/C12H11ClN2O6S/c1-20-10-5-11(9(13)4-8(10)12(16)17)22(18,19)14-6-7-2-3-21-15-7/h2-5,14H,6H2,1H3,(H,16,17) |
| InChIKey | FPMGWHLHWCASRU-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 118.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.75 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |