C10H12ClNO6S — CID 120606769
2-[(2-chloro-4,5-dimethoxyphenyl)sulfonylamino]acetic acid (PubChem CID 120606769) has the molecular formula C10H12ClNO6S and a molecular weight of 309.73 g/mol. Its IUPAC name is 2-[(2-chloro-4,5-dimethoxyphenyl)sulfonylamino]acetic acid.
| Compound Name | 2-[(2-chloro-4,5-dimethoxyphenyl)sulfonylamino]acetic acid |
|---|---|
| PubChem CID | 120606769 |
| Molecular Formula | C10H12ClNO6S |
| Molecular Weight | 309.73 g/mol |
| Exact Mass | 309.01 |
| IUPAC Name | 2-[(2-chloro-4,5-dimethoxyphenyl)sulfonylamino]acetic acid |
| SMILES | COc1cc(Cl)c(S(=O)(=O)NCC(=O)O)cc1OC |
| InChI | InChI=1S/C10H12ClNO6S/c1-17-7-3-6(11)9(4-8(7)18-2)19(15,16)12-5-10(13)14/h3-4,12H,5H2,1-2H3,(H,13,14) |
| InChIKey | WOSWMUBRGRGAEW-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.73 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |