2-[(2-chloro-4,5-dimethoxyphenyl)sulfonylamino]acetic acid

C10H12ClNO6S — CID 120606769

IUPAC2-[(2-chloro-4,5-dimethoxyphenyl)sulfonylamino]acetic acid
SMILESCOc1cc(Cl)c(S(=O)(=O)NCC(=O)O)cc1OC
InChIInChI=1S/C10H12ClNO6S/c1-17-7-3-6(11)9(4-8(7)18-2)19(15,16)12-5-10(13)14/h3-4,12H,5H2,1-2H3,(H,13,14)
InChIKeyWOSWMUBRGRGAEW-UHFFFAOYSA-N
MW309.73 g/mol
LogP0.72
Rot. Bonds6

About 2-[(2-chloro-4,5-dimethoxyphenyl)sulfonylamino]acetic acid

2-[(2-chloro-4,5-dimethoxyphenyl)sulfonylamino]acetic acid (PubChem CID 120606769) has the molecular formula C10H12ClNO6S and a molecular weight of 309.73 g/mol. Its IUPAC name is 2-[(2-chloro-4,5-dimethoxyphenyl)sulfonylamino]acetic acid.

Molecular Properties

Compound Name2-[(2-chloro-4,5-dimethoxyphenyl)sulfonylamino]acetic acid
PubChem CID120606769
Molecular FormulaC10H12ClNO6S
Molecular Weight309.73 g/mol
Exact Mass309.01
IUPAC Name2-[(2-chloro-4,5-dimethoxyphenyl)sulfonylamino]acetic acid
SMILESCOc1cc(Cl)c(S(=O)(=O)NCC(=O)O)cc1OC
InChIInChI=1S/C10H12ClNO6S/c1-17-7-3-6(11)9(4-8(7)18-2)19(15,16)12-5-10(13)14/h3-4,12H,5H2,1-2H3,(H,13,14)
InChIKeyWOSWMUBRGRGAEW-UHFFFAOYSA-N
XLogP0.72
TPSA101.93 Ų
H-Bond Donors2
H-Bond Acceptors5
Rotatable Bonds6
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500309.73
LogP ≤ 50.72
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 105

Analyze 2-[(2-chloro-4,5-dimethoxyphenyl)sulfonylamino]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[(2-chloro-4,5-dimethoxyphenyl)sulfonylamino]acetic acid?
The IUPAC name of 2-[(2-chloro-4,5-dimethoxyphenyl)sulfonylamino]acetic acid (CID 120606769) is 2-[(2-chloro-4,5-dimethoxyphenyl)sulfonylamino]acetic acid.
What is the SMILES notation for 2-[(2-chloro-4,5-dimethoxyphenyl)sulfonylamino]acetic acid?
The canonical SMILES for 2-[(2-chloro-4,5-dimethoxyphenyl)sulfonylamino]acetic acid is COc1cc(Cl)c(S(=O)(=O)NCC(=O)O)cc1OC.
What is the InChIKey of 2-[(2-chloro-4,5-dimethoxyphenyl)sulfonylamino]acetic acid?
The InChIKey is WOSWMUBRGRGAEW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12ClNO6S/c1-17-7-3-6(11)9(4-8(7)18-2)19(15,16)12-5-10(13)14/h3-4,12H,5H2,1-2H3,(H,13,14).
What are the key properties of 2-[(2-chloro-4,5-dimethoxyphenyl)sulfonylamino]acetic acid?
2-[(2-chloro-4,5-dimethoxyphenyl)sulfonylamino]acetic acid has a molecular weight of 309.73 g/mol, XLogP of 0.72, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2-chloro-4,5-dimethoxyphenyl)sulfonylamino]acetic acid is sourced from PubChem (CID 120606769), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).