C17H28Cl2N2O4S — CID 120711359
2-chloro-N-[2-(cycloheptylamino)ethyl]-4,5-dimethoxybenzenesulfonamide;hydrochloride (PubChem CID 120711359) has the molecular formula C17H28Cl2N2O4S and a molecular weight of 427.39 g/mol. Its IUPAC name is 2-chloro-N-[2-(cycloheptylamino)ethyl]-4,5-dimethoxybenzenesulfonamide;hydrochloride.
| Compound Name | 2-chloro-N-[2-(cycloheptylamino)ethyl]-4,5-dimethoxybenzenesulfonamide;hydrochloride |
|---|---|
| PubChem CID | 120711359 |
| Molecular Formula | C17H28Cl2N2O4S |
| Molecular Weight | 427.39 g/mol |
| Exact Mass | 426.11 |
| IUPAC Name | 2-chloro-N-[2-(cycloheptylamino)ethyl]-4,5-dimethoxybenzenesulfonamide;hydrochloride |
| SMILES | COc1cc(Cl)c(S(=O)(=O)NCCNC2CCCCCC2)cc1OC.Cl |
| InChI | InChI=1S/C17H27ClN2O4S.ClH/c1-23-15-11-14(18)17(12-16(15)24-2)25(21,22)20-10-9-19-13-7-5-3-4-6-8-13;/h11-13,19-20H,3-10H2,1-2H3;1H |
| InChIKey | PJILKUVZSRNGQB-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.39 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|