C15H27ClN4O3S — CID 119987196
4-[2-(cycloheptylamino)ethylsulfamoyl]-1-methylpyrrole-2-carboxamide;hydrochloride (PubChem CID 119987196) has the molecular formula C15H27ClN4O3S and a molecular weight of 378.93 g/mol. Its IUPAC name is 4-[2-(cycloheptylamino)ethylsulfamoyl]-1-methylpyrrole-2-carboxamide;hydrochloride.
| Compound Name | 4-[2-(cycloheptylamino)ethylsulfamoyl]-1-methylpyrrole-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119987196 |
| Molecular Formula | C15H27ClN4O3S |
| Molecular Weight | 378.93 g/mol |
| Exact Mass | 378.15 |
| IUPAC Name | 4-[2-(cycloheptylamino)ethylsulfamoyl]-1-methylpyrrole-2-carboxamide;hydrochloride |
| SMILES | Cl.Cn1cc(S(=O)(=O)NCCNC2CCCCCC2)cc1C(N)=O |
| InChI | InChI=1S/C15H26N4O3S.ClH/c1-19-11-13(10-14(19)15(16)20)23(21,22)18-9-8-17-12-6-4-2-3-5-7-12;/h10-12,17-18H,2-9H2,1H3,(H2,16,20);1H |
| InChIKey | LSAXQJINHKJIBO-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 106.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.93 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|