C16H27ClN4O2 — CID 119621202
2-N-[2-(cycloheptylamino)ethyl]-1-methylpyrrole-2,4-dicarboxamide;hydrochloride (PubChem CID 119621202) has the molecular formula C16H27ClN4O2 and a molecular weight of 342.87 g/mol. Its IUPAC name is 2-N-[2-(cycloheptylamino)ethyl]-1-methylpyrrole-2,4-dicarboxamide;hydrochloride.
| Compound Name | 2-N-[2-(cycloheptylamino)ethyl]-1-methylpyrrole-2,4-dicarboxamide;hydrochloride |
|---|---|
| PubChem CID | 119621202 |
| Molecular Formula | C16H27ClN4O2 |
| Molecular Weight | 342.87 g/mol |
| Exact Mass | 342.18 |
| IUPAC Name | 2-N-[2-(cycloheptylamino)ethyl]-1-methylpyrrole-2,4-dicarboxamide;hydrochloride |
| SMILES | Cl.Cn1cc(C(N)=O)cc1C(=O)NCCNC1CCCCCC1 |
| InChI | InChI=1S/C16H26N4O2.ClH/c1-20-11-12(15(17)21)10-14(20)16(22)19-9-8-18-13-6-4-2-3-5-7-13;/h10-11,13,18H,2-9H2,1H3,(H2,17,21)(H,19,22);1H |
| InChIKey | SZDATIJVLOFUFI-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 89.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.87 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|