C19H29Cl2N5O3 — CID 119619498
N-[2-(cycloheptylamino)ethyl]-1,3-dimethyl-2,4-dioxopyrido[2,3-d]pyrimidine-6-carboxamide;dihydrochloride (PubChem CID 119619498) has the molecular formula C19H29Cl2N5O3 and a molecular weight of 446.38 g/mol. Its IUPAC name is N-[2-(cycloheptylamino)ethyl]-1,3-dimethyl-2,4-dioxopyrido[2,3-d]pyrimidine-6-carboxamide;dihydrochloride.
| Compound Name | N-[2-(cycloheptylamino)ethyl]-1,3-dimethyl-2,4-dioxopyrido[2,3-d]pyrimidine-6-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 119619498 |
| Molecular Formula | C19H29Cl2N5O3 |
| Molecular Weight | 446.38 g/mol |
| Exact Mass | 445.16 |
| IUPAC Name | N-[2-(cycloheptylamino)ethyl]-1,3-dimethyl-2,4-dioxopyrido[2,3-d]pyrimidine-6-carboxamide;dihydrochloride |
| SMILES | Cl.Cl.Cn1c(=O)c2cc(C(=O)NCCNC3CCCCCC3)cnc2n(C)c1=O |
| InChI | InChI=1S/C19H27N5O3.2ClH/c1-23-16-15(18(26)24(2)19(23)27)11-13(12-22-16)17(25)21-10-9-20-14-7-5-3-4-6-8-14;;/h11-12,14,20H,3-10H2,1-2H3,(H,21,25);2*1H |
| InChIKey | UUENMNAWGMLGJO-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 98.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.38 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|