C19H28N6O3 — CID 78867565
1,3-dimethyl-N-[4-(4-methylpiperazin-1-yl)butyl]-2,4-dioxopyrido[2,3-d]pyrimidine-6-carboxamide (PubChem CID 78867565) has the molecular formula C19H28N6O3 and a molecular weight of 388.47 g/mol. Its IUPAC name is 1,3-dimethyl-N-[4-(4-methylpiperazin-1-yl)butyl]-2,4-dioxopyrido[2,3-d]pyrimidine-6-carboxamide.
| Compound Name | 1,3-dimethyl-N-[4-(4-methylpiperazin-1-yl)butyl]-2,4-dioxopyrido[2,3-d]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 78867565 |
| Molecular Formula | C19H28N6O3 |
| Molecular Weight | 388.47 g/mol |
| Exact Mass | 388.22 |
| IUPAC Name | 1,3-dimethyl-N-[4-(4-methylpiperazin-1-yl)butyl]-2,4-dioxopyrido[2,3-d]pyrimidine-6-carboxamide |
| SMILES | CN1CCN(CCCCNC(=O)c2cnc3c(c2)c(=O)n(C)c(=O)n3C)CC1 |
| InChI | InChI=1S/C19H28N6O3/c1-22-8-10-25(11-9-22)7-5-4-6-20-17(26)14-12-15-16(21-13-14)23(2)19(28)24(3)18(15)27/h12-13H,4-11H2,1-3H3,(H,20,26) |
| InChIKey | LUIDTCWPQIJECF-UHFFFAOYSA-N |
| XLogP | -0.61 |
| TPSA | 92.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.47 |
| LogP ≤ 5 | -0.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|