C10H20Cl2N6O — CID 70121204
4-amino-1-methyl-N-[2-[(1-methyldiaziridin-3-yl)amino]ethyl]pyrrole-2-carboxamide;dihydrochloride (PubChem CID 70121204) has the molecular formula C10H20Cl2N6O and a molecular weight of 311.22 g/mol. Its IUPAC name is 4-amino-1-methyl-N-[2-[(1-methyldiaziridin-3-yl)amino]ethyl]pyrrole-2-carboxamide;dihydrochloride.
| Compound Name | 4-amino-1-methyl-N-[2-[(1-methyldiaziridin-3-yl)amino]ethyl]pyrrole-2-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 70121204 |
| Molecular Formula | C10H20Cl2N6O |
| Molecular Weight | 311.22 g/mol |
| Exact Mass | 310.11 |
| IUPAC Name | 4-amino-1-methyl-N-[2-[(1-methyldiaziridin-3-yl)amino]ethyl]pyrrole-2-carboxamide;dihydrochloride |
| SMILES | CN1NC1NCCNC(=O)c1cc(N)cn1C.Cl.Cl |
| InChI | InChI=1S/C10H18N6O.2ClH/c1-15-6-7(11)5-8(15)9(17)12-3-4-13-10-14-16(10)2;;/h5-6,10,13-14H,3-4,11H2,1-2H3,(H,12,17);2*1H |
| InChIKey | ONKFBPDNZVSHMK-UHFFFAOYSA-N |
| XLogP | -0.50 |
| TPSA | 97.03 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.22 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|