C8H11Cl2N3O — CID 130551753
4-amino-N-(2,2-dichloroethyl)-1-methylpyrrole-2-carboxamide (PubChem CID 130551753) has the molecular formula C8H11Cl2N3O and a molecular weight of 236.10 g/mol. Its IUPAC name is 4-amino-N-(2,2-dichloroethyl)-1-methylpyrrole-2-carboxamide.
| Compound Name | 4-amino-N-(2,2-dichloroethyl)-1-methylpyrrole-2-carboxamide |
|---|---|
| PubChem CID | 130551753 |
| Molecular Formula | C8H11Cl2N3O |
| Molecular Weight | 236.10 g/mol |
| Exact Mass | 235.03 |
| IUPAC Name | 4-amino-N-(2,2-dichloroethyl)-1-methylpyrrole-2-carboxamide |
| SMILES | Cn1cc(N)cc1C(=O)NCC(Cl)Cl |
| InChI | InChI=1S/C8H11Cl2N3O/c1-13-4-5(11)2-6(13)8(14)12-3-7(9)10/h2,4,7H,3,11H2,1H3,(H,12,14) |
| InChIKey | LOCRBOWOTDQGDB-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 60.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.10 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|