C12H22N4O — CID 62636568
4-amino-1-methyl-N-[2-[methyl(propan-2-yl)amino]ethyl]pyrrole-2-carboxamide (PubChem CID 62636568) has the molecular formula C12H22N4O and a molecular weight of 238.33 g/mol. Its IUPAC name is 4-amino-1-methyl-N-[2-[methyl(propan-2-yl)amino]ethyl]pyrrole-2-carboxamide.
| Compound Name | 4-amino-1-methyl-N-[2-[methyl(propan-2-yl)amino]ethyl]pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 62636568 |
| Molecular Formula | C12H22N4O |
| Molecular Weight | 238.33 g/mol |
| Exact Mass | 238.18 |
| IUPAC Name | 4-amino-1-methyl-N-[2-[methyl(propan-2-yl)amino]ethyl]pyrrole-2-carboxamide |
| SMILES | CC(C)N(C)CCNC(=O)c1cc(N)cn1C |
| InChI | InChI=1S/C12H22N4O/c1-9(2)15(3)6-5-14-12(17)11-7-10(13)8-16(11)4/h7-9H,5-6,13H2,1-4H3,(H,14,17) |
| InChIKey | LEEBTWJDSRWIEX-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 63.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.33 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |