C9H16N6O — CID 85397824
4-amino-N-[2-(diaminomethylideneamino)ethyl]-1-methylpyrrole-2-carboxamide (PubChem CID 85397824) has the molecular formula C9H16N6O and a molecular weight of 224.27 g/mol. Its IUPAC name is 4-amino-N-[2-(diaminomethylideneamino)ethyl]-1-methylpyrrole-2-carboxamide.
| Compound Name | 4-amino-N-[2-(diaminomethylideneamino)ethyl]-1-methylpyrrole-2-carboxamide |
|---|---|
| PubChem CID | 85397824 |
| Molecular Formula | C9H16N6O |
| Molecular Weight | 224.27 g/mol |
| Exact Mass | 224.14 |
| IUPAC Name | 4-amino-N-[2-(diaminomethylideneamino)ethyl]-1-methylpyrrole-2-carboxamide |
| SMILES | Cn1cc(N)cc1C(=O)NCCN=C(N)N |
| InChI | InChI=1S/C9H16N6O/c1-15-5-6(10)4-7(15)8(16)13-2-3-14-9(11)12/h4-5H,2-3,10H2,1H3,(H,13,16)(H4,11,12,14) |
| InChIKey | JNRIMUBCWDXQOR-UHFFFAOYSA-N |
| XLogP | -1.39 |
| TPSA | 124.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.27 |
| LogP ≤ 5 | -1.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|