C15H23ClN8O3 — CID 142656969
4-amino-N-[5-[2-[[amino-(hydroxyamino)methylidene]amino]ethylcarbamoyl]-1-methylpyrrol-3-yl]-1-methylpyrrole-2-carboxamide;hydrochloride (PubChem CID 142656969) has the molecular formula C15H23ClN8O3 and a molecular weight of 398.86 g/mol. Its IUPAC name is 4-amino-N-[5-[2-[[amino-(hydroxyamino)methylidene]amino]ethylcarbamoyl]-1-methylpyrrol-3-yl]-1-methylpyrrole-2-carboxamide;hydrochloride.
| Compound Name | 4-amino-N-[5-[2-[[amino-(hydroxyamino)methylidene]amino]ethylcarbamoyl]-1-methylpyrrol-3-yl]-1-methylpyrrole-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 142656969 |
| Molecular Formula | C15H23ClN8O3 |
| Molecular Weight | 398.86 g/mol |
| Exact Mass | 398.16 |
| IUPAC Name | 4-amino-N-[5-[2-[[amino-(hydroxyamino)methylidene]amino]ethylcarbamoyl]-1-methylpyrrol-3-yl]-1-methylpyrrole-2-carboxamide;hydrochloride |
| SMILES | Cl.Cn1cc(NC(=O)c2cc(N)cn2C)cc1C(=O)NCC/N=C(\N)NO |
| InChI | InChI=1S/C15H22N8O3.ClH/c1-22-7-9(16)5-11(22)14(25)20-10-6-12(23(2)8-10)13(24)18-3-4-19-15(17)21-26;/h5-8,26H,3-4,16H2,1-2H3,(H,18,24)(H,20,25)(H3,17,19,21);1H |
| InChIKey | RSJFPCWFKRJCHI-UHFFFAOYSA-N |
| XLogP | -0.36 |
| TPSA | 164.72 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.86 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|