C16H24N8O2 — CID 70120898
4-amino-1-methyl-N-[1-methyl-5-[2-[(N'-methylcarbamimidoyl)amino]ethylcarbamoyl]pyrrol-3-yl]pyrrole-2-carboxamide (PubChem CID 70120898) has the molecular formula C16H24N8O2 and a molecular weight of 360.42 g/mol. Its IUPAC name is 4-amino-1-methyl-N-[1-methyl-5-[2-[(N'-methylcarbamimidoyl)amino]ethylcarbamoyl]pyrrol-3-yl]pyrrole-2-carboxamide.
| Compound Name | 4-amino-1-methyl-N-[1-methyl-5-[2-[(N'-methylcarbamimidoyl)amino]ethylcarbamoyl]pyrrol-3-yl]pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 70120898 |
| Molecular Formula | C16H24N8O2 |
| Molecular Weight | 360.42 g/mol |
| Exact Mass | 360.20 |
| IUPAC Name | 4-amino-1-methyl-N-[1-methyl-5-[2-[(N'-methylcarbamimidoyl)amino]ethylcarbamoyl]pyrrol-3-yl]pyrrole-2-carboxamide |
| SMILES | C/N=C(\N)NCCNC(=O)c1cc(NC(=O)c2cc(N)cn2C)cn1C |
| InChI | InChI=1S/C16H24N8O2/c1-19-16(18)21-5-4-20-14(25)13-7-11(9-24(13)3)22-15(26)12-6-10(17)8-23(12)2/h6-9H,4-5,17H2,1-3H3,(H,20,25)(H,22,26)(H3,18,19,21) |
| InChIKey | QPNKBWPMJKSEEN-UHFFFAOYSA-N |
| XLogP | -0.54 |
| TPSA | 144.49 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.42 |
| LogP ≤ 5 | -0.54 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|