C22H30N10O3 — CID 70120878
4-amino-N-[5-[[5-[2-(hydrazinylmethylideneamino)propylcarbamoyl]-1-methylpyrrol-3-yl]carbamoyl]-1-methylpyrrol-3-yl]-1-methylpyrrole-2-carboxamide (PubChem CID 70120878) has the molecular formula C22H30N10O3 and a molecular weight of 482.55 g/mol. Its IUPAC name is 4-amino-N-[5-[[5-[2-(hydrazinylmethylideneamino)propylcarbamoyl]-1-methylpyrrol-3-yl]carbamoyl]-1-methylpyrrol-3-yl]-1-methylpyrrole-2-carboxamide.
| Compound Name | 4-amino-N-[5-[[5-[2-(hydrazinylmethylideneamino)propylcarbamoyl]-1-methylpyrrol-3-yl]carbamoyl]-1-methylpyrrol-3-yl]-1-methylpyrrole-2-carboxamide |
|---|---|
| PubChem CID | 70120878 |
| Molecular Formula | C22H30N10O3 |
| Molecular Weight | 482.55 g/mol |
| Exact Mass | 482.25 |
| IUPAC Name | 4-amino-N-[5-[[5-[2-(hydrazinylmethylideneamino)propylcarbamoyl]-1-methylpyrrol-3-yl]carbamoyl]-1-methylpyrrol-3-yl]-1-methylpyrrole-2-carboxamide |
| SMILES | CC(CNC(=O)c1cc(NC(=O)c2cc(NC(=O)c3cc(N)cn3C)cn2C)cn1C)/N=C/NN |
| InChI | InChI=1S/C22H30N10O3/c1-13(26-12-27-24)8-25-20(33)18-6-15(10-31(18)3)29-22(35)19-7-16(11-32(19)4)28-21(34)17-5-14(23)9-30(17)2/h5-7,9-13H,8,23-24H2,1-4H3,(H,25,33)(H,26,27)(H,28,34)(H,29,35) |
| InChIKey | GSFCGXVXYKBQNI-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 178.52 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.55 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|