C16H18F2N6O2 — CID 59682177
N-[2-(diaminomethylideneamino)ethyl]-4-[(2,4-difluorobenzoyl)amino]-1-methylpyrrole-2-carboxamide (PubChem CID 59682177) has the molecular formula C16H18F2N6O2 and a molecular weight of 364.36 g/mol. Its IUPAC name is N-[2-(diaminomethylideneamino)ethyl]-4-[(2,4-difluorobenzoyl)amino]-1-methylpyrrole-2-carboxamide.
| Compound Name | N-[2-(diaminomethylideneamino)ethyl]-4-[(2,4-difluorobenzoyl)amino]-1-methylpyrrole-2-carboxamide |
|---|---|
| PubChem CID | 59682177 |
| Molecular Formula | C16H18F2N6O2 |
| Molecular Weight | 364.36 g/mol |
| Exact Mass | 364.15 |
| IUPAC Name | N-[2-(diaminomethylideneamino)ethyl]-4-[(2,4-difluorobenzoyl)amino]-1-methylpyrrole-2-carboxamide |
| SMILES | Cn1cc(NC(=O)c2ccc(F)cc2F)cc1C(=O)NCCN=C(N)N |
| InChI | InChI=1S/C16H18F2N6O2/c1-24-8-10(7-13(24)15(26)21-4-5-22-16(19)20)23-14(25)11-3-2-9(17)6-12(11)18/h2-3,6-8H,4-5H2,1H3,(H,21,26)(H,23,25)(H4,19,20,22) |
| InChIKey | XCRALXZLNGCPDB-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 127.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.36 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|