C23H28ClN11O4 — CID 57295848
3-(2-chloroprop-2-enoylamino)-N-[5-[[5-[2-(diaminomethylideneamino)ethylcarbamoyl]-1-methylpyrrol-3-yl]carbamoyl]-1-methylpyrrol-3-yl]-1-methylpyrazole-5-carboxamide (PubChem CID 57295848) has the molecular formula C23H28ClN11O4 and a molecular weight of 558.00 g/mol. Its IUPAC name is 3-(2-chloroprop-2-enoylamino)-N-[5-[[5-[2-(diaminomethylideneamino)ethylcarbamoyl]-1-methylpyrrol-3-yl]carbamoyl]-1-methylpyrrol-3-yl]-1-methylpyrazole-5-carboxamide.
| Compound Name | 3-(2-chloroprop-2-enoylamino)-N-[5-[[5-[2-(diaminomethylideneamino)ethylcarbamoyl]-1-methylpyrrol-3-yl]carbamoyl]-1-methylpyrrol-3-yl]-1-methylpyrazole-5-carboxamide |
|---|---|
| PubChem CID | 57295848 |
| Molecular Formula | C23H28ClN11O4 |
| Molecular Weight | 558.00 g/mol |
| Exact Mass | 557.20 |
| IUPAC Name | 3-(2-chloroprop-2-enoylamino)-N-[5-[[5-[2-(diaminomethylideneamino)ethylcarbamoyl]-1-methylpyrrol-3-yl]carbamoyl]-1-methylpyrrol-3-yl]-1-methylpyrazole-5-carboxamide |
| SMILES | C=C(Cl)C(=O)Nc1cc(C(=O)Nc2cc(C(=O)Nc3cc(C(=O)NCCN=C(N)N)n(C)c3)n(C)c2)n(C)n1 |
| InChI | InChI=1S/C23H28ClN11O4/c1-12(24)19(36)31-18-9-17(35(4)32-18)22(39)30-14-8-16(34(3)11-14)21(38)29-13-7-15(33(2)10-13)20(37)27-5-6-28-23(25)26/h7-11H,1,5-6H2,2-4H3,(H,27,37)(H,29,38)(H,30,39)(H4,25,26,28)(H,31,32,36) |
| InChIKey | PGLZAKZUVIQOSF-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 208.48 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.00 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|